C10H15F2N3 — CID 105244787
2-(2,4-difluorophenyl)-2-hydrazinyl-N,N-dimethylethanamine (PubChem CID 105244787) has the molecular formula C10H15F2N3 and a molecular weight of 215.25 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)-2-hydrazinyl-N,N-dimethylethanamine.
| Compound Name | 2-(2,4-difluorophenyl)-2-hydrazinyl-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 105244787 |
| Molecular Formula | C10H15F2N3 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.12 |
| IUPAC Name | 2-(2,4-difluorophenyl)-2-hydrazinyl-N,N-dimethylethanamine |
| SMILES | CN(C)CC(NN)c1ccc(F)cc1F |
| InChI | InChI=1S/C10H15F2N3/c1-15(2)6-10(14-13)8-4-3-7(11)5-9(8)12/h3-5,10,14H,6,13H2,1-2H3 |
| InChIKey | DAVFLGDDIMAFHS-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|