C17H29FN2 — CID 62644965
N'-butyl-N,N'-diethyl-1-(3-fluorophenyl)propane-1,3-diamine (PubChem CID 62644965) has the molecular formula C17H29FN2 and a molecular weight of 280.43 g/mol. Its IUPAC name is N'-butyl-N,N'-diethyl-1-(3-fluorophenyl)propane-1,3-diamine.
| Compound Name | N'-butyl-N,N'-diethyl-1-(3-fluorophenyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 62644965 |
| Molecular Formula | C17H29FN2 |
| Molecular Weight | 280.43 g/mol |
| Exact Mass | 280.23 |
| IUPAC Name | N'-butyl-N,N'-diethyl-1-(3-fluorophenyl)propane-1,3-diamine |
| SMILES | CCCCN(CC)CCC(NCC)c1cccc(F)c1 |
| InChI | InChI=1S/C17H29FN2/c1-4-7-12-20(6-3)13-11-17(19-5-2)15-9-8-10-16(18)14-15/h8-10,14,17,19H,4-7,11-13H2,1-3H3 |
| InChIKey | LNIWOASWEPYWGO-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.43 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |