C17H29BrN2 — CID 63483594
1-(2-bromophenyl)-N'-butyl-N,N'-diethylpropane-1,3-diamine (PubChem CID 63483594) has the molecular formula C17H29BrN2 and a molecular weight of 341.34 g/mol. Its IUPAC name is 1-(2-bromophenyl)-N'-butyl-N,N'-diethylpropane-1,3-diamine.
| Compound Name | 1-(2-bromophenyl)-N'-butyl-N,N'-diethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 63483594 |
| Molecular Formula | C17H29BrN2 |
| Molecular Weight | 341.34 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | 1-(2-bromophenyl)-N'-butyl-N,N'-diethylpropane-1,3-diamine |
| SMILES | CCCCN(CC)CCC(NCC)c1ccccc1Br |
| InChI | InChI=1S/C17H29BrN2/c1-4-7-13-20(6-3)14-12-17(19-5-2)15-10-8-9-11-16(15)18/h8-11,17,19H,4-7,12-14H2,1-3H3 |
| InChIKey | WMLYQJFHKGEXDL-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.34 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |