C16H27BrN2O — CID 63009011
1-(2-bromophenyl)-N-ethyl-N'-(3-methoxypropyl)-N'-methylpropane-1,3-diamine (PubChem CID 63009011) has the molecular formula C16H27BrN2O and a molecular weight of 343.31 g/mol. Its IUPAC name is 1-(2-bromophenyl)-N-ethyl-N'-(3-methoxypropyl)-N'-methylpropane-1,3-diamine.
| Compound Name | 1-(2-bromophenyl)-N-ethyl-N'-(3-methoxypropyl)-N'-methylpropane-1,3-diamine |
|---|---|
| PubChem CID | 63009011 |
| Molecular Formula | C16H27BrN2O |
| Molecular Weight | 343.31 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | 1-(2-bromophenyl)-N-ethyl-N'-(3-methoxypropyl)-N'-methylpropane-1,3-diamine |
| SMILES | CCNC(CCN(C)CCCOC)c1ccccc1Br |
| InChI | InChI=1S/C16H27BrN2O/c1-4-18-16(14-8-5-6-9-15(14)17)10-12-19(2)11-7-13-20-3/h5-6,8-9,16,18H,4,7,10-13H2,1-3H3 |
| InChIKey | NAMMRZTYHVNKGY-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.31 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|