C17H18BrClIN — CID 103220364
N-[(4-bromo-2,5-dimethylphenyl)-(3-chloro-4-iodophenyl)methyl]ethanamine (PubChem CID 103220364) has the molecular formula C17H18BrClIN and a molecular weight of 478.60 g/mol. Its IUPAC name is N-[(4-bromo-2,5-dimethylphenyl)-(3-chloro-4-iodophenyl)methyl]ethanamine.
| Compound Name | N-[(4-bromo-2,5-dimethylphenyl)-(3-chloro-4-iodophenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 103220364 |
| Molecular Formula | C17H18BrClIN |
| Molecular Weight | 478.60 g/mol |
| Exact Mass | 476.94 |
| IUPAC Name | N-[(4-bromo-2,5-dimethylphenyl)-(3-chloro-4-iodophenyl)methyl]ethanamine |
| SMILES | CCNC(c1ccc(I)c(Cl)c1)c1cc(C)c(Br)cc1C |
| InChI | InChI=1S/C17H18BrClIN/c1-4-21-17(12-5-6-16(20)15(19)9-12)13-7-11(3)14(18)8-10(13)2/h5-9,17,21H,4H2,1-3H3 |
| InChIKey | LMDGNLGIWQGBEB-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.60 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|