C15H13Br2ClIN — CID 103220094
N-[(3-chloro-4-iodophenyl)-(2,5-dibromophenyl)methyl]ethanamine (PubChem CID 103220094) has the molecular formula C15H13Br2ClIN and a molecular weight of 529.44 g/mol. Its IUPAC name is N-[(3-chloro-4-iodophenyl)-(2,5-dibromophenyl)methyl]ethanamine.
| Compound Name | N-[(3-chloro-4-iodophenyl)-(2,5-dibromophenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 103220094 |
| Molecular Formula | C15H13Br2ClIN |
| Molecular Weight | 529.44 g/mol |
| Exact Mass | 526.81 |
| IUPAC Name | N-[(3-chloro-4-iodophenyl)-(2,5-dibromophenyl)methyl]ethanamine |
| SMILES | CCNC(c1ccc(I)c(Cl)c1)c1cc(Br)ccc1Br |
| InChI | InChI=1S/C15H13Br2ClIN/c1-2-20-15(9-3-6-14(19)13(18)7-9)11-8-10(16)4-5-12(11)17/h3-8,15,20H,2H2,1H3 |
| InChIKey | UQBSTYFXUNELLP-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.44 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|