C15H12ClF3IN — CID 103302706
N-[(3-chloro-4-iodophenyl)-(2,4,5-trifluorophenyl)methyl]ethanamine (PubChem CID 103302706) has the molecular formula C15H12ClF3IN and a molecular weight of 425.62 g/mol. Its IUPAC name is N-[(3-chloro-4-iodophenyl)-(2,4,5-trifluorophenyl)methyl]ethanamine.
| Compound Name | N-[(3-chloro-4-iodophenyl)-(2,4,5-trifluorophenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 103302706 |
| Molecular Formula | C15H12ClF3IN |
| Molecular Weight | 425.62 g/mol |
| Exact Mass | 424.97 |
| IUPAC Name | N-[(3-chloro-4-iodophenyl)-(2,4,5-trifluorophenyl)methyl]ethanamine |
| SMILES | CCNC(c1ccc(I)c(Cl)c1)c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C15H12ClF3IN/c1-2-21-15(8-3-4-14(20)10(16)5-8)9-6-12(18)13(19)7-11(9)17/h3-7,15,21H,2H2,1H3 |
| InChIKey | GOEZGOZSRUUMPN-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.62 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|