C16H16Br2IN — CID 81473949
N-[(2,5-dibromo-4-methylphenyl)-(4-iodophenyl)methyl]ethanamine (PubChem CID 81473949) has the molecular formula C16H16Br2IN and a molecular weight of 509.02 g/mol. Its IUPAC name is N-[(2,5-dibromo-4-methylphenyl)-(4-iodophenyl)methyl]ethanamine.
| Compound Name | N-[(2,5-dibromo-4-methylphenyl)-(4-iodophenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 81473949 |
| Molecular Formula | C16H16Br2IN |
| Molecular Weight | 509.02 g/mol |
| Exact Mass | 506.87 |
| IUPAC Name | N-[(2,5-dibromo-4-methylphenyl)-(4-iodophenyl)methyl]ethanamine |
| SMILES | CCNC(c1ccc(I)cc1)c1cc(Br)c(C)cc1Br |
| InChI | InChI=1S/C16H16Br2IN/c1-3-20-16(11-4-6-12(19)7-5-11)13-9-14(17)10(2)8-15(13)18/h4-9,16,20H,3H2,1-2H3 |
| InChIKey | ABJKDERBCWCVDA-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.02 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|