C13H13BrINS — CID 80535832
N-[(3-bromothiophen-2-yl)-(4-iodophenyl)methyl]ethanamine (PubChem CID 80535832) has the molecular formula C13H13BrINS and a molecular weight of 422.13 g/mol. Its IUPAC name is N-[(3-bromothiophen-2-yl)-(4-iodophenyl)methyl]ethanamine.
| Compound Name | N-[(3-bromothiophen-2-yl)-(4-iodophenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 80535832 |
| Molecular Formula | C13H13BrINS |
| Molecular Weight | 422.13 g/mol |
| Exact Mass | 420.90 |
| IUPAC Name | N-[(3-bromothiophen-2-yl)-(4-iodophenyl)methyl]ethanamine |
| SMILES | CCNC(c1ccc(I)cc1)c1sccc1Br |
| InChI | InChI=1S/C13H13BrINS/c1-2-16-12(13-11(14)7-8-17-13)9-3-5-10(15)6-4-9/h3-8,12,16H,2H2,1H3 |
| InChIKey | CRRMDTPPYKTLAB-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.13 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|