C14H16BrClIN3 — CID 103216273
N-[(4-bromo-1-ethylpyrazol-5-yl)-(3-chloro-4-iodophenyl)methyl]ethanamine (PubChem CID 103216273) has the molecular formula C14H16BrClIN3 and a molecular weight of 468.56 g/mol. Its IUPAC name is N-[(4-bromo-1-ethylpyrazol-5-yl)-(3-chloro-4-iodophenyl)methyl]ethanamine.
| Compound Name | N-[(4-bromo-1-ethylpyrazol-5-yl)-(3-chloro-4-iodophenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 103216273 |
| Molecular Formula | C14H16BrClIN3 |
| Molecular Weight | 468.56 g/mol |
| Exact Mass | 466.93 |
| IUPAC Name | N-[(4-bromo-1-ethylpyrazol-5-yl)-(3-chloro-4-iodophenyl)methyl]ethanamine |
| SMILES | CCNC(c1ccc(I)c(Cl)c1)c1c(Br)cnn1CC |
| InChI | InChI=1S/C14H16BrClIN3/c1-3-18-13(9-5-6-12(17)11(16)7-9)14-10(15)8-19-20(14)4-2/h5-8,13,18H,3-4H2,1-2H3 |
| InChIKey | LRGSCTIMLDKOMA-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.56 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|