C16H20F3N — CID 63505798
N-[cyclohexen-1-yl-[4-(trifluoromethyl)phenyl]methyl]ethanamine (PubChem CID 63505798) has the molecular formula C16H20F3N and a molecular weight of 283.34 g/mol. Its IUPAC name is N-[cyclohexen-1-yl-[4-(trifluoromethyl)phenyl]methyl]ethanamine.
| Compound Name | N-[cyclohexen-1-yl-[4-(trifluoromethyl)phenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 63505798 |
| Molecular Formula | C16H20F3N |
| Molecular Weight | 283.34 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | N-[cyclohexen-1-yl-[4-(trifluoromethyl)phenyl]methyl]ethanamine |
| SMILES | CCNC(C1=CCCCC1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H20F3N/c1-2-20-15(12-6-4-3-5-7-12)13-8-10-14(11-9-13)16(17,18)19/h6,8-11,15,20H,2-5,7H2,1H3 |
| InChIKey | WMHFACMZOXIGJW-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.34 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|