C14H18IN — CID 62078356
N-[cyclopenten-1-yl-(2-iodophenyl)methyl]ethanamine (PubChem CID 62078356) has the molecular formula C14H18IN and a molecular weight of 327.21 g/mol. Its IUPAC name is N-[cyclopenten-1-yl-(2-iodophenyl)methyl]ethanamine.
| Compound Name | N-[cyclopenten-1-yl-(2-iodophenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 62078356 |
| Molecular Formula | C14H18IN |
| Molecular Weight | 327.21 g/mol |
| Exact Mass | 327.05 |
| IUPAC Name | N-[cyclopenten-1-yl-(2-iodophenyl)methyl]ethanamine |
| SMILES | CCNC(C1=CCCC1)c1ccccc1I |
| InChI | InChI=1S/C14H18IN/c1-2-16-14(11-7-3-4-8-11)12-9-5-6-10-13(12)15/h5-7,9-10,14,16H,2-4,8H2,1H3 |
| InChIKey | OQFKRAVABVGNHU-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.21 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|