C27H37NO3 — CID 102067171
butyl (E,2S,6R)-6-methyl-2-[[(1R)-1-phenylethyl]amino]-7-phenylmethoxyhept-4-enoate (PubChem CID 102067171) has the molecular formula C27H37NO3 and a molecular weight of 423.60 g/mol. Its IUPAC name is butyl (E,2S,6R)-6-methyl-2-[[(1R)-1-phenylethyl]amino]-7-phenylmethoxyhept-4-enoate.
| Compound Name | butyl (E,2S,6R)-6-methyl-2-[[(1R)-1-phenylethyl]amino]-7-phenylmethoxyhept-4-enoate |
|---|---|
| PubChem CID | 102067171 |
| Molecular Formula | C27H37NO3 |
| Molecular Weight | 423.60 g/mol |
| Exact Mass | 423.28 |
| IUPAC Name | butyl (E,2S,6R)-6-methyl-2-[[(1R)-1-phenylethyl]amino]-7-phenylmethoxyhept-4-enoate |
| SMILES | CCCCOC(=O)[C@H](C/C=C/[C@@H](C)COCc1ccccc1)N[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C27H37NO3/c1-4-5-19-31-27(29)26(28-23(3)25-16-10-7-11-17-25)18-12-13-22(2)20-30-21-24-14-8-6-9-15-24/h6-17,22-23,26,28H,4-5,18-21H2,1-3H3/b13-12+/t22-,23-,26+/m1/s1 |
| InChIKey | UUJXGJKWMNFWAV-GBGKTDLFSA-N |
| XLogP | 5.85 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.60 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|