C16H11F4NO4 — CID 71887902
[2-oxo-2-(phenylmethoxyamino)ethyl] 2,3,4,5-tetrafluorobenzoate (PubChem CID 71887902) has the molecular formula C16H11F4NO4 and a molecular weight of 357.26 g/mol. Its IUPAC name is [2-oxo-2-(phenylmethoxyamino)ethyl] 2,3,4,5-tetrafluorobenzoate.
| Compound Name | [2-oxo-2-(phenylmethoxyamino)ethyl] 2,3,4,5-tetrafluorobenzoate |
|---|---|
| PubChem CID | 71887902 |
| Molecular Formula | C16H11F4NO4 |
| Molecular Weight | 357.26 g/mol |
| Exact Mass | 357.06 |
| IUPAC Name | [2-oxo-2-(phenylmethoxyamino)ethyl] 2,3,4,5-tetrafluorobenzoate |
| SMILES | O=C(COC(=O)c1cc(F)c(F)c(F)c1F)NOCc1ccccc1 |
| InChI | InChI=1S/C16H11F4NO4/c17-11-6-10(13(18)15(20)14(11)19)16(23)24-8-12(22)21-25-7-9-4-2-1-3-5-9/h1-6H,7-8H2,(H,21,22) |
| InChIKey | ZPCMTKNUANTUBA-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.26 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|