C16H8F5NOS — CID 112769783
2-(4-fluorophenyl)-4-[(2,3,5,6-tetrafluorophenoxy)methyl]-1,3-thiazole (PubChem CID 112769783) has the molecular formula C16H8F5NOS and a molecular weight of 357.30 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-4-[(2,3,5,6-tetrafluorophenoxy)methyl]-1,3-thiazole.
| Compound Name | 2-(4-fluorophenyl)-4-[(2,3,5,6-tetrafluorophenoxy)methyl]-1,3-thiazole |
|---|---|
| PubChem CID | 112769783 |
| Molecular Formula | C16H8F5NOS |
| Molecular Weight | 357.30 g/mol |
| Exact Mass | 357.02 |
| IUPAC Name | 2-(4-fluorophenyl)-4-[(2,3,5,6-tetrafluorophenoxy)methyl]-1,3-thiazole |
| SMILES | Fc1ccc(-c2nc(COc3c(F)c(F)cc(F)c3F)cs2)cc1 |
| InChI | InChI=1S/C16H8F5NOS/c17-9-3-1-8(2-4-9)16-22-10(7-24-16)6-23-15-13(20)11(18)5-12(19)14(15)21/h1-5,7H,6H2 |
| InChIKey | JFCFTSMRQGRRNK-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.30 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|