C14H12Br2O4S — CID 63529529
3-bromo-4-[(4-bromothiophen-2-yl)methoxy]-5-ethoxybenzoic acid (PubChem CID 63529529) has the molecular formula C14H12Br2O4S and a molecular weight of 436.12 g/mol. Its IUPAC name is 3-bromo-4-[(4-bromothiophen-2-yl)methoxy]-5-ethoxybenzoic acid.
| Compound Name | 3-bromo-4-[(4-bromothiophen-2-yl)methoxy]-5-ethoxybenzoic acid |
|---|---|
| PubChem CID | 63529529 |
| Molecular Formula | C14H12Br2O4S |
| Molecular Weight | 436.12 g/mol |
| Exact Mass | 433.88 |
| IUPAC Name | 3-bromo-4-[(4-bromothiophen-2-yl)methoxy]-5-ethoxybenzoic acid |
| SMILES | CCOc1cc(C(=O)O)cc(Br)c1OCc1cc(Br)cs1 |
| InChI | InChI=1S/C14H12Br2O4S/c1-2-19-12-4-8(14(17)18)3-11(16)13(12)20-6-10-5-9(15)7-21-10/h3-5,7H,2,6H2,1H3,(H,17,18) |
| InChIKey | CSJJKUQIICTXRZ-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.12 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |