C14H9Br2Cl2FO — CID 107745489
1,3-dibromo-2-[(2-chloro-3-fluorophenyl)methoxy]-5-(chloromethyl)benzene (PubChem CID 107745489) has the molecular formula C14H9Br2Cl2FO and a molecular weight of 442.94 g/mol. Its IUPAC name is 1,3-dibromo-2-[(2-chloro-3-fluorophenyl)methoxy]-5-(chloromethyl)benzene.
| Compound Name | 1,3-dibromo-2-[(2-chloro-3-fluorophenyl)methoxy]-5-(chloromethyl)benzene |
|---|---|
| PubChem CID | 107745489 |
| Molecular Formula | C14H9Br2Cl2FO |
| Molecular Weight | 442.94 g/mol |
| Exact Mass | 439.84 |
| IUPAC Name | 1,3-dibromo-2-[(2-chloro-3-fluorophenyl)methoxy]-5-(chloromethyl)benzene |
| SMILES | Fc1cccc(COc2c(Br)cc(CCl)cc2Br)c1Cl |
| InChI | InChI=1S/C14H9Br2Cl2FO/c15-10-4-8(6-17)5-11(16)14(10)20-7-9-2-1-3-12(19)13(9)18/h1-5H,6-7H2 |
| InChIKey | LIAPRSCBMDWXAP-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.94 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|