C15H12Br2ClFO — CID 107745450
1,3-dibromo-5-(chloromethyl)-2-[(5-fluoro-2-methylphenyl)methoxy]benzene (PubChem CID 107745450) has the molecular formula C15H12Br2ClFO and a molecular weight of 422.52 g/mol. Its IUPAC name is 1,3-dibromo-5-(chloromethyl)-2-[(5-fluoro-2-methylphenyl)methoxy]benzene.
| Compound Name | 1,3-dibromo-5-(chloromethyl)-2-[(5-fluoro-2-methylphenyl)methoxy]benzene |
|---|---|
| PubChem CID | 107745450 |
| Molecular Formula | C15H12Br2ClFO |
| Molecular Weight | 422.52 g/mol |
| Exact Mass | 419.89 |
| IUPAC Name | 1,3-dibromo-5-(chloromethyl)-2-[(5-fluoro-2-methylphenyl)methoxy]benzene |
| SMILES | Cc1ccc(F)cc1COc1c(Br)cc(CCl)cc1Br |
| InChI | InChI=1S/C15H12Br2ClFO/c1-9-2-3-12(19)6-11(9)8-20-15-13(16)4-10(7-18)5-14(15)17/h2-6H,7-8H2,1H3 |
| InChIKey | QRIMXCZARBSDBX-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.52 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|