C18H21ClO — CID 63535326
5-(chloromethyl)-2-[(2,5-dimethylphenyl)methoxy]-1,3-dimethylbenzene (PubChem CID 63535326) has the molecular formula C18H21ClO and a molecular weight of 288.82 g/mol. Its IUPAC name is 5-(chloromethyl)-2-[(2,5-dimethylphenyl)methoxy]-1,3-dimethylbenzene.
| Compound Name | 5-(chloromethyl)-2-[(2,5-dimethylphenyl)methoxy]-1,3-dimethylbenzene |
|---|---|
| PubChem CID | 63535326 |
| Molecular Formula | C18H21ClO |
| Molecular Weight | 288.82 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | 5-(chloromethyl)-2-[(2,5-dimethylphenyl)methoxy]-1,3-dimethylbenzene |
| SMILES | Cc1ccc(C)c(COc2c(C)cc(CCl)cc2C)c1 |
| InChI | InChI=1S/C18H21ClO/c1-12-5-6-13(2)17(7-12)11-20-18-14(3)8-16(10-19)9-15(18)4/h5-9H,10-11H2,1-4H3 |
| InChIKey | ITTCEEYZEPYTGI-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.82 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|