C7H3Cl2N3OS — CID 172684469
2-(4,6-dichloropyrimidin-2-yl)sulfanyl-1,3-oxazole (PubChem CID 172684469) has the molecular formula C7H3Cl2N3OS and a molecular weight of 248.09 g/mol. Its IUPAC name is 2-(4,6-dichloropyrimidin-2-yl)sulfanyl-1,3-oxazole.
| Compound Name | 2-(4,6-dichloropyrimidin-2-yl)sulfanyl-1,3-oxazole |
|---|---|
| PubChem CID | 172684469 |
| Molecular Formula | C7H3Cl2N3OS |
| Molecular Weight | 248.09 g/mol |
| Exact Mass | 246.94 |
| IUPAC Name | 2-(4,6-dichloropyrimidin-2-yl)sulfanyl-1,3-oxazole |
| SMILES | Clc1cc(Cl)nc(Sc2ncco2)n1 |
| InChI | InChI=1S/C7H3Cl2N3OS/c8-4-3-5(9)12-6(11-4)14-7-10-1-2-13-7/h1-3H |
| InChIKey | AVRUGUZWWLSQNY-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.09 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |