C11H9NO2S — CID 106926334
2-methyl-4-(1,3-oxazol-2-ylsulfanyl)benzaldehyde (PubChem CID 106926334) has the molecular formula C11H9NO2S and a molecular weight of 219.27 g/mol. Its IUPAC name is 2-methyl-4-(1,3-oxazol-2-ylsulfanyl)benzaldehyde.
| Compound Name | 2-methyl-4-(1,3-oxazol-2-ylsulfanyl)benzaldehyde |
|---|---|
| PubChem CID | 106926334 |
| Molecular Formula | C11H9NO2S |
| Molecular Weight | 219.27 g/mol |
| Exact Mass | 219.04 |
| IUPAC Name | 2-methyl-4-(1,3-oxazol-2-ylsulfanyl)benzaldehyde |
| SMILES | Cc1cc(Sc2ncco2)ccc1C=O |
| InChI | InChI=1S/C11H9NO2S/c1-8-6-10(3-2-9(8)7-13)15-11-12-4-5-14-11/h2-7H,1H3 |
| InChIKey | UHLGFKWVJVWQRF-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.27 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|