C10H6N2O4S — CID 106926348
5-nitro-2-(1,3-oxazol-2-ylsulfanyl)benzaldehyde (PubChem CID 106926348) has the molecular formula C10H6N2O4S and a molecular weight of 250.24 g/mol. Its IUPAC name is 5-nitro-2-(1,3-oxazol-2-ylsulfanyl)benzaldehyde.
| Compound Name | 5-nitro-2-(1,3-oxazol-2-ylsulfanyl)benzaldehyde |
|---|---|
| PubChem CID | 106926348 |
| Molecular Formula | C10H6N2O4S |
| Molecular Weight | 250.24 g/mol |
| Exact Mass | 250.00 |
| IUPAC Name | 5-nitro-2-(1,3-oxazol-2-ylsulfanyl)benzaldehyde |
| SMILES | O=Cc1cc([N+](=O)[O-])ccc1Sc1ncco1 |
| InChI | InChI=1S/C10H6N2O4S/c13-6-7-5-8(12(14)15)1-2-9(7)17-10-11-3-4-16-10/h1-6H |
| InChIKey | XHHPABLVPJJZLU-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 86.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.24 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|