C10H7NO2S — CID 106926336
2-(1,3-oxazol-2-ylsulfanyl)benzaldehyde (PubChem CID 106926336) has the molecular formula C10H7NO2S and a molecular weight of 205.24 g/mol. Its IUPAC name is 2-(1,3-oxazol-2-ylsulfanyl)benzaldehyde.
| Compound Name | 2-(1,3-oxazol-2-ylsulfanyl)benzaldehyde |
|---|---|
| PubChem CID | 106926336 |
| Molecular Formula | C10H7NO2S |
| Molecular Weight | 205.24 g/mol |
| Exact Mass | 205.02 |
| IUPAC Name | 2-(1,3-oxazol-2-ylsulfanyl)benzaldehyde |
| SMILES | O=Cc1ccccc1Sc1ncco1 |
| InChI | InChI=1S/C10H7NO2S/c12-7-8-3-1-2-4-9(8)14-10-11-5-6-13-10/h1-7H |
| InChIKey | USWFFYHSSBXEIN-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.24 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|