C13H15NO5S — CID 107746095
2-[(2-methyloxolan-3-yl)sulfanylmethyl]-6-nitrobenzoic acid (PubChem CID 107746095) has the molecular formula C13H15NO5S and a molecular weight of 297.33 g/mol. Its IUPAC name is 2-[(2-methyloxolan-3-yl)sulfanylmethyl]-6-nitrobenzoic acid.
| Compound Name | 2-[(2-methyloxolan-3-yl)sulfanylmethyl]-6-nitrobenzoic acid |
|---|---|
| PubChem CID | 107746095 |
| Molecular Formula | C13H15NO5S |
| Molecular Weight | 297.33 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | 2-[(2-methyloxolan-3-yl)sulfanylmethyl]-6-nitrobenzoic acid |
| SMILES | CC1OCCC1SCc1cccc([N+](=O)[O-])c1C(=O)O |
| InChI | InChI=1S/C13H15NO5S/c1-8-11(5-6-19-8)20-7-9-3-2-4-10(14(17)18)12(9)13(15)16/h2-4,8,11H,5-7H2,1H3,(H,15,16) |
| InChIKey | ZAHCZCXFZNIAJA-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 89.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.33 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|