C12H9FN2O4S2 — CID 107347812
2-[(2-fluoro-3-nitrophenyl)methylsulfanyl]-4-methyl-1,3-thiazole-5-carboxylic acid (PubChem CID 107347812) has the molecular formula C12H9FN2O4S2 and a molecular weight of 328.35 g/mol. Its IUPAC name is 2-[(2-fluoro-3-nitrophenyl)methylsulfanyl]-4-methyl-1,3-thiazole-5-carboxylic acid.
| Compound Name | 2-[(2-fluoro-3-nitrophenyl)methylsulfanyl]-4-methyl-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 107347812 |
| Molecular Formula | C12H9FN2O4S2 |
| Molecular Weight | 328.35 g/mol |
| Exact Mass | 328.00 |
| IUPAC Name | 2-[(2-fluoro-3-nitrophenyl)methylsulfanyl]-4-methyl-1,3-thiazole-5-carboxylic acid |
| SMILES | Cc1nc(SCc2cccc([N+](=O)[O-])c2F)sc1C(=O)O |
| InChI | InChI=1S/C12H9FN2O4S2/c1-6-10(11(16)17)21-12(14-6)20-5-7-3-2-4-8(9(7)13)15(18)19/h2-4H,5H2,1H3,(H,16,17) |
| InChIKey | UIRWUXDUCDUQSJ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 93.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.35 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|