C11H6ClFN2O4S2 — CID 66078731
2-(4-chloro-5-fluoro-2-nitrophenyl)sulfanyl-4-methyl-1,3-thiazole-5-carboxylic acid (PubChem CID 66078731) has the molecular formula C11H6ClFN2O4S2 and a molecular weight of 348.76 g/mol. Its IUPAC name is 2-(4-chloro-5-fluoro-2-nitrophenyl)sulfanyl-4-methyl-1,3-thiazole-5-carboxylic acid.
| Compound Name | 2-(4-chloro-5-fluoro-2-nitrophenyl)sulfanyl-4-methyl-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 66078731 |
| Molecular Formula | C11H6ClFN2O4S2 |
| Molecular Weight | 348.76 g/mol |
| Exact Mass | 347.94 |
| IUPAC Name | 2-(4-chloro-5-fluoro-2-nitrophenyl)sulfanyl-4-methyl-1,3-thiazole-5-carboxylic acid |
| SMILES | Cc1nc(Sc2cc(F)c(Cl)cc2[N+](=O)[O-])sc1C(=O)O |
| InChI | InChI=1S/C11H6ClFN2O4S2/c1-4-9(10(16)17)21-11(14-4)20-8-3-6(13)5(12)2-7(8)15(18)19/h2-3H,1H3,(H,16,17) |
| InChIKey | SXGWBXYDAMRPGY-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 93.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.76 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|