About 2-(4-chloro-5-fluoro-2-nitrophenyl)sulfanyl-4-methyl-1,3-thiazole-5-carboxylic acid
2-(4-chloro-5-fluoro-2-nitrophenyl)sulfanyl-4-methyl-1,3-thiazole-5-carboxylic acid (PubChem CID 66078731) has the molecular formula C11H6ClFN2O4S2
and a molecular weight of 348.76 g/mol. Its IUPAC name is 2-(4-chloro-5-fluoro-2-nitrophenyl)sulfanyl-4-methyl-1,3-thiazole-5-carboxylic acid.
Molecular Properties
| Compound Name | 2-(4-chloro-5-fluoro-2-nitrophenyl)sulfanyl-4-methyl-1,3-thiazole-5-carboxylic acid |
| PubChem CID | 66078731 |
| Molecular Formula | C11H6ClFN2O4S2 |
| Molecular Weight | 348.76 g/mol |
| Exact Mass | 347.94 |
| IUPAC Name | 2-(4-chloro-5-fluoro-2-nitrophenyl)sulfanyl-4-methyl-1,3-thiazole-5-carboxylic acid |
| SMILES | Cc1nc(Sc2cc(F)c(Cl)cc2[N+](=O)[O-])sc1C(=O)O |
| InChI | InChI=1S/C11H6ClFN2O4S2/c1-4-9(10(16)17)21-11(14-4)20-8-3-6(13)5(12)2-7(8)15(18)19/h2-3H,1H3,(H,16,17) |
| InChIKey | SXGWBXYDAMRPGY-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 93.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.76 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-chloro-5-fluoro-2-nitrophenyl)sulfanyl-4-methyl-1,3-thiazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-chloro-5-fluoro-2-nitrophenyl)sulfanyl-4-methyl-1,3-thiazole-5-carboxylic acid?
The IUPAC name of 2-(4-chloro-5-fluoro-2-nitrophenyl)sulfanyl-4-methyl-1,3-thiazole-5-carboxylic acid (CID 66078731) is 2-(4-chloro-5-fluoro-2-nitrophenyl)sulfanyl-4-methyl-1,3-thiazole-5-carboxylic acid.
What is the SMILES notation for 2-(4-chloro-5-fluoro-2-nitrophenyl)sulfanyl-4-methyl-1,3-thiazole-5-carboxylic acid?
The canonical SMILES for 2-(4-chloro-5-fluoro-2-nitrophenyl)sulfanyl-4-methyl-1,3-thiazole-5-carboxylic acid is Cc1nc(Sc2cc(F)c(Cl)cc2[N+](=O)[O-])sc1C(=O)O.
What is the InChIKey of 2-(4-chloro-5-fluoro-2-nitrophenyl)sulfanyl-4-methyl-1,3-thiazole-5-carboxylic acid?
The InChIKey is SXGWBXYDAMRPGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H6ClFN2O4S2/c1-4-9(10(16)17)21-11(14-4)20-8-3-6(13)5(12)2-7(8)15(18)19/h2-3H,1H3,(H,16,17).
What are the key properties of 2-(4-chloro-5-fluoro-2-nitrophenyl)sulfanyl-4-methyl-1,3-thiazole-5-carboxylic acid?
2-(4-chloro-5-fluoro-2-nitrophenyl)sulfanyl-4-methyl-1,3-thiazole-5-carboxylic acid has a molecular weight of 348.76 g/mol, XLogP of 4.00, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-chloro-5-fluoro-2-nitrophenyl)sulfanyl-4-methyl-1,3-thiazole-5-carboxylic acid is sourced from PubChem (CID 66078731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).