C11H6N4O4S2 — CID 103470149
2-[(6-cyano-5-nitro-2-pyridinyl)sulfanyl]-4-methyl-1,3-thiazole-5-carboxylic acid (PubChem CID 103470149) has the molecular formula C11H6N4O4S2 and a molecular weight of 322.33 g/mol. Its IUPAC name is 2-[(6-cyano-5-nitro-2-pyridinyl)sulfanyl]-4-methyl-1,3-thiazole-5-carboxylic acid.
| Compound Name | 2-[(6-cyano-5-nitro-2-pyridinyl)sulfanyl]-4-methyl-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 103470149 |
| Molecular Formula | C11H6N4O4S2 |
| Molecular Weight | 322.33 g/mol |
| Exact Mass | 321.98 |
| IUPAC Name | 2-[(6-cyano-5-nitro-2-pyridinyl)sulfanyl]-4-methyl-1,3-thiazole-5-carboxylic acid |
| SMILES | Cc1nc(Sc2ccc([N+](=O)[O-])c(C#N)n2)sc1C(=O)O |
| InChI | InChI=1S/C11H6N4O4S2/c1-5-9(10(16)17)21-11(13-5)20-8-3-2-7(15(18)19)6(4-12)14-8/h2-3H,1H3,(H,16,17) |
| InChIKey | IKXZNJOBVOZVAL-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 130.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.33 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|