C9H15N5OS — CID 106679440
4-(3-aminopyrazin-2-yl)sulfanylpentanehydrazide (PubChem CID 106679440) has the molecular formula C9H15N5OS and a molecular weight of 241.32 g/mol. Its IUPAC name is 4-(3-aminopyrazin-2-yl)sulfanylpentanehydrazide.
| Compound Name | 4-(3-aminopyrazin-2-yl)sulfanylpentanehydrazide |
|---|---|
| PubChem CID | 106679440 |
| Molecular Formula | C9H15N5OS |
| Molecular Weight | 241.32 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | 4-(3-aminopyrazin-2-yl)sulfanylpentanehydrazide |
| SMILES | CC(CCC(=O)NN)Sc1nccnc1N |
| InChI | InChI=1S/C9H15N5OS/c1-6(2-3-7(15)14-11)16-9-8(10)12-4-5-13-9/h4-6H,2-3,11H2,1H3,(H2,10,12)(H,14,15) |
| InChIKey | WMYLNKIRTKFDPN-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 106.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.32 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|