C11H16BrN3OS — CID 63590454
4-(2-amino-4-bromophenyl)sulfanylpentanehydrazide (PubChem CID 63590454) has the molecular formula C11H16BrN3OS and a molecular weight of 318.24 g/mol. Its IUPAC name is 4-(2-amino-4-bromophenyl)sulfanylpentanehydrazide.
| Compound Name | 4-(2-amino-4-bromophenyl)sulfanylpentanehydrazide |
|---|---|
| PubChem CID | 63590454 |
| Molecular Formula | C11H16BrN3OS |
| Molecular Weight | 318.24 g/mol |
| Exact Mass | 317.02 |
| IUPAC Name | 4-(2-amino-4-bromophenyl)sulfanylpentanehydrazide |
| SMILES | CC(CCC(=O)NN)Sc1ccc(Br)cc1N |
| InChI | InChI=1S/C11H16BrN3OS/c1-7(2-5-11(16)15-14)17-10-4-3-8(12)6-9(10)13/h3-4,6-7H,2,5,13-14H2,1H3,(H,15,16) |
| InChIKey | CXPWAACSXFWUEP-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.24 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|