C18H22N6O — CID 143158639
4-[(6-acetyl-1H-benzimidazol-2-yl)methylamino]benzenecarboximidamide;methanamine (PubChem CID 143158639) has the molecular formula C18H22N6O and a molecular weight of 338.42 g/mol. Its IUPAC name is 4-[(6-acetyl-1H-benzimidazol-2-yl)methylamino]benzenecarboximidamide;methanamine.
| Compound Name | 4-[(6-acetyl-1H-benzimidazol-2-yl)methylamino]benzenecarboximidamide;methanamine |
|---|---|
| PubChem CID | 143158639 |
| Molecular Formula | C18H22N6O |
| Molecular Weight | 338.42 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | 4-[(6-acetyl-1H-benzimidazol-2-yl)methylamino]benzenecarboximidamide;methanamine |
| SMILES | CN.[H]/N=C(\N)c1ccc(NCc2nc3ccc(C(C)=O)cc3[nH]2)cc1 |
| InChI | InChI=1S/C17H17N5O.CH5N/c1-10(23)12-4-7-14-15(8-12)22-16(21-14)9-20-13-5-2-11(3-6-13)17(18)19;1-2/h2-8,20H,9H2,1H3,(H3,18,19)(H,21,22);2H2,1H3 |
| InChIKey | VYZUADSCUGYGTD-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 133.67 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.42 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|