C16H16N4 — CID 59910528
4-(1-aminoethenyl)-N-(1H-benzimidazol-2-ylmethyl)aniline (PubChem CID 59910528) has the molecular formula C16H16N4 and a molecular weight of 264.33 g/mol. Its IUPAC name is 4-(1-aminoethenyl)-N-(1H-benzimidazol-2-ylmethyl)aniline.
| Compound Name | 4-(1-aminoethenyl)-N-(1H-benzimidazol-2-ylmethyl)aniline |
|---|---|
| PubChem CID | 59910528 |
| Molecular Formula | C16H16N4 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | 4-(1-aminoethenyl)-N-(1H-benzimidazol-2-ylmethyl)aniline |
| SMILES | C=C(N)c1ccc(NCc2nc3ccccc3[nH]2)cc1 |
| InChI | InChI=1S/C16H16N4/c1-11(17)12-6-8-13(9-7-12)18-10-16-19-14-4-2-3-5-15(14)20-16/h2-9,18H,1,10,17H2,(H,19,20) |
| InChIKey | JYDYISULPHJCBD-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |