C22H23N9 — CID 50899640
4-[[3-azido-5-[(4-carbamimidoylanilino)methyl]phenyl]methylamino]benzenecarboximidamide (PubChem CID 50899640) has the molecular formula C22H23N9 and a molecular weight of 413.49 g/mol. Its IUPAC name is 4-[[3-azido-5-[(4-carbamimidoylanilino)methyl]phenyl]methylamino]benzenecarboximidamide.
| Compound Name | 4-[[3-azido-5-[(4-carbamimidoylanilino)methyl]phenyl]methylamino]benzenecarboximidamide |
|---|---|
| PubChem CID | 50899640 |
| Molecular Formula | C22H23N9 |
| Molecular Weight | 413.49 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | 4-[[3-azido-5-[(4-carbamimidoylanilino)methyl]phenyl]methylamino]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(NCc2cc(CNc3ccc(/C(N)=N/[H])cc3)cc(N=[N+]=[N-])c2)cc1 |
| InChI | InChI=1S/C22H23N9/c23-21(24)16-1-5-18(6-2-16)28-12-14-9-15(11-20(10-14)30-31-27)13-29-19-7-3-17(4-8-19)22(25)26/h1-11,28-29H,12-13H2,(H3,23,24)(H3,25,26) |
| InChIKey | DUDVUSDYJCUMGS-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 172.56 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.49 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|