C14H14BrN5 — CID 142938524
4-[(4-bromophenyl)methylamino]-N'-diazenylbenzenecarboximidamide (PubChem CID 142938524) has the molecular formula C14H14BrN5 and a molecular weight of 332.21 g/mol. Its IUPAC name is 4-[(4-bromophenyl)methylamino]-N'-diazenylbenzenecarboximidamide.
| Compound Name | 4-[(4-bromophenyl)methylamino]-N'-diazenylbenzenecarboximidamide |
|---|---|
| PubChem CID | 142938524 |
| Molecular Formula | C14H14BrN5 |
| Molecular Weight | 332.21 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | 4-[(4-bromophenyl)methylamino]-N'-diazenylbenzenecarboximidamide |
| SMILES | [H]/N=N/N=C(N)c1ccc(NCc2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C14H14BrN5/c15-12-5-1-10(2-6-12)9-18-13-7-3-11(4-8-13)14(16)19-20-17/h1-8,18H,9H2,(H3,16,17,19) |
| InChIKey | UMZYRVLHXVTUSE-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 86.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.21 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|