C15H17N5 — CID 154542315
N'-diazenyl-4-[(2-methylphenyl)methylamino]benzenecarboximidamide (PubChem CID 154542315) has the molecular formula C15H17N5 and a molecular weight of 267.34 g/mol. Its IUPAC name is N'-diazenyl-4-[(2-methylphenyl)methylamino]benzenecarboximidamide.
| Compound Name | N'-diazenyl-4-[(2-methylphenyl)methylamino]benzenecarboximidamide |
|---|---|
| PubChem CID | 154542315 |
| Molecular Formula | C15H17N5 |
| Molecular Weight | 267.34 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | N'-diazenyl-4-[(2-methylphenyl)methylamino]benzenecarboximidamide |
| SMILES | [H]/N=N/N=C(N)c1ccc(NCc2ccccc2C)cc1 |
| InChI | InChI=1S/C15H17N5/c1-11-4-2-3-5-13(11)10-18-14-8-6-12(7-9-14)15(16)19-20-17/h2-9,18H,10H2,1H3,(H3,16,17,19) |
| InChIKey | QLPIUHOHFMADMY-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 86.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.34 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|