C18H25N5O6 — CID 15027264
(2S)-2-[[(2S)-3-carboxy-2-[[4-[(diaminomethylideneamino)methyl]benzoyl]amino]propanoyl]amino]-3-methylbutanoic acid (PubChem CID 15027264) has the molecular formula C18H25N5O6 and a molecular weight of 407.43 g/mol. Its IUPAC name is (2S)-2-[[(2S)-3-carboxy-2-[[4-[(diaminomethylideneamino)methyl]benzoyl]amino]propanoyl]amino]-3-methylbutanoic acid.
| Compound Name | (2S)-2-[[(2S)-3-carboxy-2-[[4-[(diaminomethylideneamino)methyl]benzoyl]amino]propanoyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 15027264 |
| Molecular Formula | C18H25N5O6 |
| Molecular Weight | 407.43 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | (2S)-2-[[(2S)-3-carboxy-2-[[4-[(diaminomethylideneamino)methyl]benzoyl]amino]propanoyl]amino]-3-methylbutanoic acid |
| SMILES | CC(C)[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)c1ccc(CN=C(N)N)cc1)C(=O)O |
| InChI | InChI=1S/C18H25N5O6/c1-9(2)14(17(28)29)23-16(27)12(7-13(24)25)22-15(26)11-5-3-10(4-6-11)8-21-18(19)20/h3-6,9,12,14H,7-8H2,1-2H3,(H,22,26)(H,23,27)(H,24,25)(H,28,29)(H4,19,20,21)/t12-,14-/m0/s1 |
| InChIKey | GCOAJVLLWJTQES-JSGCOSHPSA-N |
| XLogP | -0.74 |
| TPSA | 197.20 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.43 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|