C24H35NO6 — CID 130250617
4-[11-(1-carboxypent-4-enylamino)-11-oxoundecoxy]benzoic acid (PubChem CID 130250617) has the molecular formula C24H35NO6 and a molecular weight of 433.55 g/mol. Its IUPAC name is 4-[11-(1-carboxypent-4-enylamino)-11-oxoundecoxy]benzoic acid.
| Compound Name | 4-[11-(1-carboxypent-4-enylamino)-11-oxoundecoxy]benzoic acid |
|---|---|
| PubChem CID | 130250617 |
| Molecular Formula | C24H35NO6 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.25 |
| IUPAC Name | 4-[11-(1-carboxypent-4-enylamino)-11-oxoundecoxy]benzoic acid |
| SMILES | C=CCCC(NC(=O)CCCCCCCCCCOc1ccc(C(=O)O)cc1)C(=O)O |
| InChI | InChI=1S/C24H35NO6/c1-2-3-12-21(24(29)30)25-22(26)13-10-8-6-4-5-7-9-11-18-31-20-16-14-19(15-17-20)23(27)28/h2,14-17,21H,1,3-13,18H2,(H,25,26)(H,27,28)(H,29,30) |
| InChIKey | UVIRMJXBFPSOCH-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|