C32H51N3O12 — CID 87349724
4-[10-[[(1S)-1-carboxy-4-[2-[2-[1-[2-(2-hydroxyethoxy)ethylamino]-2-oxoethoxy]ethoxy]ethylamino]-4-oxobutyl]amino]-10-oxodecoxy]benzoic acid (PubChem CID 87349724) has the molecular formula C32H51N3O12 and a molecular weight of 669.77 g/mol. Its IUPAC name is 4-[10-[[(1S)-1-carboxy-4-[2-[2-[1-[2-(2-hydroxyethoxy)ethylamino]-2-oxoethoxy]ethoxy]ethylamino]-4-oxobutyl]amino]-10-oxodecoxy]benzoic acid.
| Compound Name | 4-[10-[[(1S)-1-carboxy-4-[2-[2-[1-[2-(2-hydroxyethoxy)ethylamino]-2-oxoethoxy]ethoxy]ethylamino]-4-oxobutyl]amino]-10-oxodecoxy]benzoic acid |
|---|---|
| PubChem CID | 87349724 |
| Molecular Formula | C32H51N3O12 |
| Molecular Weight | 669.77 g/mol |
| Exact Mass | 669.35 |
| IUPAC Name | 4-[10-[[(1S)-1-carboxy-4-[2-[2-[1-[2-(2-hydroxyethoxy)ethylamino]-2-oxoethoxy]ethoxy]ethylamino]-4-oxobutyl]amino]-10-oxodecoxy]benzoic acid |
| SMILES | O=CC(NCCOCCO)OCCOCCNC(=O)CC[C@H](NC(=O)CCCCCCCCCOc1ccc(C(=O)O)cc1)C(=O)O |
| InChI | InChI=1S/C32H51N3O12/c36-17-21-44-20-16-34-30(24-37)47-23-22-45-19-15-33-28(38)14-13-27(32(42)43)35-29(39)8-6-4-2-1-3-5-7-18-46-26-11-9-25(10-12-26)31(40)41/h9-12,24,27,30,34,36H,1-8,13-23H2,(H,33,38)(H,35,39)(H,40,41)(H,42,43)/t27-,30?/m0/s1 |
| InChIKey | NMGHJKKBDVEWLF-CEBUJLNPSA-N |
| XLogP | 1.51 |
| TPSA | 219.05 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.77 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|