C17H24N4O6 — CID 118927750
benzyl N-[2-[[(2-methylpropan-2-yl)oxycarbonylamino]methylcarbamoylamino]-2-oxoethyl]carbamate (PubChem CID 118927750) has the molecular formula C17H24N4O6 and a molecular weight of 380.40 g/mol. Its IUPAC name is benzyl N-[2-[[(2-methylpropan-2-yl)oxycarbonylamino]methylcarbamoylamino]-2-oxoethyl]carbamate.
| Compound Name | benzyl N-[2-[[(2-methylpropan-2-yl)oxycarbonylamino]methylcarbamoylamino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 118927750 |
| Molecular Formula | C17H24N4O6 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | benzyl N-[2-[[(2-methylpropan-2-yl)oxycarbonylamino]methylcarbamoylamino]-2-oxoethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCNC(=O)NC(=O)CNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C17H24N4O6/c1-17(2,3)27-16(25)20-11-19-14(23)21-13(22)9-18-15(24)26-10-12-7-5-4-6-8-12/h4-8H,9-11H2,1-3H3,(H,18,24)(H,20,25)(H2,19,21,22,23) |
| InChIKey | NRYKHNVDHIGVML-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 134.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|