C14H17NO6 — CID 19888342
3-[methoxycarbonyl(methyl)amino]-4-oxo-4-phenylmethoxybutanoic acid (PubChem CID 19888342) has the molecular formula C14H17NO6 and a molecular weight of 295.29 g/mol. Its IUPAC name is 3-[methoxycarbonyl(methyl)amino]-4-oxo-4-phenylmethoxybutanoic acid.
| Compound Name | 3-[methoxycarbonyl(methyl)amino]-4-oxo-4-phenylmethoxybutanoic acid |
|---|---|
| PubChem CID | 19888342 |
| Molecular Formula | C14H17NO6 |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | 3-[methoxycarbonyl(methyl)amino]-4-oxo-4-phenylmethoxybutanoic acid |
| SMILES | COC(=O)N(C)C(CC(=O)O)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C14H17NO6/c1-15(14(19)20-2)11(8-12(16)17)13(18)21-9-10-6-4-3-5-7-10/h3-7,11H,8-9H2,1-2H3,(H,16,17) |
| InChIKey | FHLRCJIBFJTHOB-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |