C45H50N4O12 — CID 91365596
(2S)-2-[[(2S)-2-[[(2S)-6-amino-2-[bis(phenylmethoxycarbonyl)amino]hexanoyl]amino]-4-carboxy-5-phenylpentanoyl]amino]-3-benzylbutanedioic acid (PubChem CID 91365596) has the molecular formula C45H50N4O12 and a molecular weight of 838.91 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[[(2S)-6-amino-2-[bis(phenylmethoxycarbonyl)amino]hexanoyl]amino]-4-carboxy-5-phenylpentanoyl]amino]-3-benzylbutanedioic acid.
| Compound Name | (2S)-2-[[(2S)-2-[[(2S)-6-amino-2-[bis(phenylmethoxycarbonyl)amino]hexanoyl]amino]-4-carboxy-5-phenylpentanoyl]amino]-3-benzylbutanedioic acid |
|---|---|
| PubChem CID | 91365596 |
| Molecular Formula | C45H50N4O12 |
| Molecular Weight | 838.91 g/mol |
| Exact Mass | 838.34 |
| IUPAC Name | (2S)-2-[[(2S)-2-[[(2S)-6-amino-2-[bis(phenylmethoxycarbonyl)amino]hexanoyl]amino]-4-carboxy-5-phenylpentanoyl]amino]-3-benzylbutanedioic acid |
| SMILES | NCCCC[C@@H](C(=O)N[C@@H](CC(Cc1ccccc1)C(=O)O)C(=O)N[C@H](C(=O)O)C(Cc1ccccc1)C(=O)O)N(C(=O)OCc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C45H50N4O12/c46-24-14-13-23-37(49(44(58)60-28-32-19-9-3-10-20-32)45(59)61-29-33-21-11-4-12-22-33)40(51)47-36(27-34(41(52)53)25-30-15-5-1-6-16-30)39(50)48-38(43(56)57)35(42(54)55)26-31-17-7-2-8-18-31/h1-12,15-22,34-38H,13-14,23-29,46H2,(H,47,51)(H,48,50)(H,52,53)(H,54,55)(H,56,57)/t34?,35?,36-,37-,38-/m0/s1 |
| InChIKey | ZAAHTEMSRIWMPB-ZXYHKWHWSA-N |
| XLogP | 4.79 |
| TPSA | 251.96 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 838.91 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|