C20H24N2O5S — CID 86633081
benzyl (1S,5S)-3,6-diazabicyclo[3.2.0]heptane-3-carboxylate;4-methylbenzenesulfonic acid (PubChem CID 86633081) has the molecular formula C20H24N2O5S and a molecular weight of 404.49 g/mol. Its IUPAC name is benzyl (1S,5S)-3,6-diazabicyclo[3.2.0]heptane-3-carboxylate;4-methylbenzenesulfonic acid.
| Compound Name | benzyl (1S,5S)-3,6-diazabicyclo[3.2.0]heptane-3-carboxylate;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 86633081 |
| Molecular Formula | C20H24N2O5S |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | benzyl (1S,5S)-3,6-diazabicyclo[3.2.0]heptane-3-carboxylate;4-methylbenzenesulfonic acid |
| SMILES | Cc1ccc(S(=O)(=O)O)cc1.O=C(OCc1ccccc1)N1C[C@@H]2CN[C@@H]2C1 |
| InChI | InChI=1S/C13H16N2O2.C7H8O3S/c16-13(15-7-11-6-14-12(11)8-15)17-9-10-4-2-1-3-5-10;1-6-2-4-7(5-3-6)11(8,9)10/h1-5,11-12,14H,6-9H2;2-5H,1H3,(H,8,9,10)/t11-,12+;/m0./s1 |
| InChIKey | ZKVMXSWYRAAHIY-ZVWHLABXSA-N |
| XLogP | 2.47 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|