C15H20N2O3 — CID 101039813
benzyl (1S,5S)-6-hydroxy-3,7-diazabicyclo[3.3.1]nonane-3-carboxylate (PubChem CID 101039813) has the molecular formula C15H20N2O3 and a molecular weight of 276.34 g/mol. Its IUPAC name is benzyl (1S,5S)-6-hydroxy-3,7-diazabicyclo[3.3.1]nonane-3-carboxylate.
| Compound Name | benzyl (1S,5S)-6-hydroxy-3,7-diazabicyclo[3.3.1]nonane-3-carboxylate |
|---|---|
| PubChem CID | 101039813 |
| Molecular Formula | C15H20N2O3 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | benzyl (1S,5S)-6-hydroxy-3,7-diazabicyclo[3.3.1]nonane-3-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1C[C@@H]2CNC(O)[C@@H](C2)C1 |
| InChI | InChI=1S/C15H20N2O3/c18-14-13-6-12(7-16-14)8-17(9-13)15(19)20-10-11-4-2-1-3-5-11/h1-5,12-14,16,18H,6-10H2/t12-,13-,14?/m0/s1 |
| InChIKey | WFTLKLKYMCNXQJ-RFHHWMCGSA-N |
| XLogP | 1.18 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |