C15H18ClF3N2O3 — CID 139450424
benzyl (3aS,6aS)-3-(trifluoromethoxy)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carboxylate;hydrochloride (PubChem CID 139450424) has the molecular formula C15H18ClF3N2O3 and a molecular weight of 366.77 g/mol. Its IUPAC name is benzyl (3aS,6aS)-3-(trifluoromethoxy)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carboxylate;hydrochloride.
| Compound Name | benzyl (3aS,6aS)-3-(trifluoromethoxy)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 139450424 |
| Molecular Formula | C15H18ClF3N2O3 |
| Molecular Weight | 366.77 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | benzyl (3aS,6aS)-3-(trifluoromethoxy)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole-5-carboxylate;hydrochloride |
| SMILES | Cl.O=C(OCc1ccccc1)N1C[C@@H]2CNC(OC(F)(F)F)[C@@H]2C1 |
| InChI | InChI=1S/C15H17F3N2O3.ClH/c16-15(17,18)23-13-12-8-20(7-11(12)6-19-13)14(21)22-9-10-4-2-1-3-5-10;/h1-5,11-13,19H,6-9H2;1H/t11-,12+,13?;/m0./s1 |
| InChIKey | JXRCZDSDRQZCTK-YGMHKCIZSA-N |
| XLogP | 2.76 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.77 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |