C28H41N3O3S — CID 67619237
(2S)-1-[4-methyl-2-[(4-methylphenyl)sulfonylamino]pentyl]-N-(4-phenylbutyl)pyrrolidine-2-carboxamide (PubChem CID 67619237) has the molecular formula C28H41N3O3S and a molecular weight of 499.72 g/mol. Its IUPAC name is (2S)-1-[4-methyl-2-[(4-methylphenyl)sulfonylamino]pentyl]-N-(4-phenylbutyl)pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-[4-methyl-2-[(4-methylphenyl)sulfonylamino]pentyl]-N-(4-phenylbutyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 67619237 |
| Molecular Formula | C28H41N3O3S |
| Molecular Weight | 499.72 g/mol |
| Exact Mass | 499.29 |
| IUPAC Name | (2S)-1-[4-methyl-2-[(4-methylphenyl)sulfonylamino]pentyl]-N-(4-phenylbutyl)pyrrolidine-2-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)NC(CC(C)C)CN2CCC[C@H]2C(=O)NCCCCc2ccccc2)cc1 |
| InChI | InChI=1S/C28H41N3O3S/c1-22(2)20-25(30-35(33,34)26-16-14-23(3)15-17-26)21-31-19-9-13-27(31)28(32)29-18-8-7-12-24-10-5-4-6-11-24/h4-6,10-11,14-17,22,25,27,30H,7-9,12-13,18-21H2,1-3H3,(H,29,32)/t25?,27-/m0/s1 |
| InChIKey | UTSHGBKDYXKINW-GPNIZQGCSA-N |
| XLogP | 4.29 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.72 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|