C30H40N4O3S — CID 67618832
(2S)-1-[4-methyl-2-(quinolin-8-ylsulfonylamino)pentyl]-N-(4-phenylbutyl)pyrrolidine-2-carboxamide (PubChem CID 67618832) has the molecular formula C30H40N4O3S and a molecular weight of 536.74 g/mol. Its IUPAC name is (2S)-1-[4-methyl-2-(quinolin-8-ylsulfonylamino)pentyl]-N-(4-phenylbutyl)pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-[4-methyl-2-(quinolin-8-ylsulfonylamino)pentyl]-N-(4-phenylbutyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 67618832 |
| Molecular Formula | C30H40N4O3S |
| Molecular Weight | 536.74 g/mol |
| Exact Mass | 536.28 |
| IUPAC Name | (2S)-1-[4-methyl-2-(quinolin-8-ylsulfonylamino)pentyl]-N-(4-phenylbutyl)pyrrolidine-2-carboxamide |
| SMILES | CC(C)CC(CN1CCC[C@H]1C(=O)NCCCCc1ccccc1)NS(=O)(=O)c1cccc2cccnc12 |
| InChI | InChI=1S/C30H40N4O3S/c1-23(2)21-26(33-38(36,37)28-17-8-14-25-15-9-19-31-29(25)28)22-34-20-10-16-27(34)30(35)32-18-7-6-13-24-11-4-3-5-12-24/h3-5,8-9,11-12,14-15,17,19,23,26-27,33H,6-7,10,13,16,18,20-22H2,1-2H3,(H,32,35)/t26?,27-/m0/s1 |
| InChIKey | POLJIMPWMONKMA-GEVKEYJPSA-N |
| XLogP | 4.53 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.74 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|