C22H37N3O3S — CID 67620449
(2S)-1-[(2R)-2-(methanesulfonamido)-4-methylpentyl]-N-(4-phenylbutyl)pyrrolidine-2-carboxamide (PubChem CID 67620449) has the molecular formula C22H37N3O3S and a molecular weight of 423.62 g/mol. Its IUPAC name is (2S)-1-[(2R)-2-(methanesulfonamido)-4-methylpentyl]-N-(4-phenylbutyl)pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-[(2R)-2-(methanesulfonamido)-4-methylpentyl]-N-(4-phenylbutyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 67620449 |
| Molecular Formula | C22H37N3O3S |
| Molecular Weight | 423.62 g/mol |
| Exact Mass | 423.26 |
| IUPAC Name | (2S)-1-[(2R)-2-(methanesulfonamido)-4-methylpentyl]-N-(4-phenylbutyl)pyrrolidine-2-carboxamide |
| SMILES | CC(C)C[C@H](CN1CCC[C@H]1C(=O)NCCCCc1ccccc1)NS(C)(=O)=O |
| InChI | InChI=1S/C22H37N3O3S/c1-18(2)16-20(24-29(3,27)28)17-25-15-9-13-21(25)22(26)23-14-8-7-12-19-10-5-4-6-11-19/h4-6,10-11,18,20-21,24H,7-9,12-17H2,1-3H3,(H,23,26)/t20-,21+/m1/s1 |
| InChIKey | TYYKQAPLNKQWLE-RTWAWAEBSA-N |
| XLogP | 2.55 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.62 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|