C25H28N4O — CID 134803452
N-(3-phenylpropyl)-1-[(4-pyrimidin-5-ylphenyl)methyl]pyrrolidine-2-carboxamide (PubChem CID 134803452) has the molecular formula C25H28N4O and a molecular weight of 400.53 g/mol. Its IUPAC name is N-(3-phenylpropyl)-1-[(4-pyrimidin-5-ylphenyl)methyl]pyrrolidine-2-carboxamide.
| Compound Name | N-(3-phenylpropyl)-1-[(4-pyrimidin-5-ylphenyl)methyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 134803452 |
| Molecular Formula | C25H28N4O |
| Molecular Weight | 400.53 g/mol |
| Exact Mass | 400.23 |
| IUPAC Name | N-(3-phenylpropyl)-1-[(4-pyrimidin-5-ylphenyl)methyl]pyrrolidine-2-carboxamide |
| SMILES | O=C(NCCCc1ccccc1)C1CCCN1Cc1ccc(-c2cncnc2)cc1 |
| InChI | InChI=1S/C25H28N4O/c30-25(28-14-4-8-20-6-2-1-3-7-20)24-9-5-15-29(24)18-21-10-12-22(13-11-21)23-16-26-19-27-17-23/h1-3,6-7,10-13,16-17,19,24H,4-5,8-9,14-15,18H2,(H,28,30) |
| InChIKey | IKOYFPQGPLYABI-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.53 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|