C32H49N3O2 — CID 67843973
(2S)-1-[(2R)-2-(adamantane-1-carbonylamino)-4-methylpentyl]-N-(4-phenylbutyl)pyrrolidine-2-carboxamide (PubChem CID 67843973) has the molecular formula C32H49N3O2 and a molecular weight of 507.76 g/mol. Its IUPAC name is (2S)-1-[(2R)-2-(adamantane-1-carbonylamino)-4-methylpentyl]-N-(4-phenylbutyl)pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-[(2R)-2-(adamantane-1-carbonylamino)-4-methylpentyl]-N-(4-phenylbutyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 67843973 |
| Molecular Formula | C32H49N3O2 |
| Molecular Weight | 507.76 g/mol |
| Exact Mass | 507.38 |
| IUPAC Name | (2S)-1-[(2R)-2-(adamantane-1-carbonylamino)-4-methylpentyl]-N-(4-phenylbutyl)pyrrolidine-2-carboxamide |
| SMILES | CC(C)C[C@H](CN1CCC[C@H]1C(=O)NCCCCc1ccccc1)NC(=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C32H49N3O2/c1-23(2)15-28(34-31(37)32-19-25-16-26(20-32)18-27(17-25)21-32)22-35-14-8-12-29(35)30(36)33-13-7-6-11-24-9-4-3-5-10-24/h3-5,9-10,23,25-29H,6-8,11-22H2,1-2H3,(H,33,36)(H,34,37)/t25?,26?,27?,28-,29+,32?/m1/s1 |
| InChIKey | LMKNPOQVZUUDDD-ZOYQXRFWSA-N |
| XLogP | 5.34 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.76 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|