C23H27NO3S — CID 51958382
[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-[3-(benzenesulfonylmethyl)phenyl]methanone (PubChem CID 51958382) has the molecular formula C23H27NO3S and a molecular weight of 397.54 g/mol. Its IUPAC name is [(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-[3-(benzenesulfonylmethyl)phenyl]methanone.
| Compound Name | [(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-[3-(benzenesulfonylmethyl)phenyl]methanone |
|---|---|
| PubChem CID | 51958382 |
| Molecular Formula | C23H27NO3S |
| Molecular Weight | 397.54 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | [(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-[3-(benzenesulfonylmethyl)phenyl]methanone |
| SMILES | O=C(c1cccc(CS(=O)(=O)c2ccccc2)c1)N1CCC[C@H]2CCCC[C@H]21 |
| InChI | InChI=1S/C23H27NO3S/c25-23(24-15-7-11-19-9-4-5-14-22(19)24)20-10-6-8-18(16-20)17-28(26,27)21-12-2-1-3-13-21/h1-3,6,8,10,12-13,16,19,22H,4-5,7,9,11,14-15,17H2/t19-,22-/m1/s1 |
| InChIKey | UCGBKONXNKUVEN-DENIHFKCSA-N |
| XLogP | 4.46 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.54 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |