C25H31N3O4S — CID 55828071
4-[3-(benzenesulfonylmethyl)benzoyl]-N-cyclohexylpiperazine-1-carboxamide (PubChem CID 55828071) has the molecular formula C25H31N3O4S and a molecular weight of 469.61 g/mol. Its IUPAC name is 4-[3-(benzenesulfonylmethyl)benzoyl]-N-cyclohexylpiperazine-1-carboxamide.
| Compound Name | 4-[3-(benzenesulfonylmethyl)benzoyl]-N-cyclohexylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 55828071 |
| Molecular Formula | C25H31N3O4S |
| Molecular Weight | 469.61 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | 4-[3-(benzenesulfonylmethyl)benzoyl]-N-cyclohexylpiperazine-1-carboxamide |
| SMILES | O=C(NC1CCCCC1)N1CCN(C(=O)c2cccc(CS(=O)(=O)c3ccccc3)c2)CC1 |
| InChI | InChI=1S/C25H31N3O4S/c29-24(27-14-16-28(17-15-27)25(30)26-22-10-3-1-4-11-22)21-9-7-8-20(18-21)19-33(31,32)23-12-5-2-6-13-23/h2,5-9,12-13,18,22H,1,3-4,10-11,14-17,19H2,(H,26,30) |
| InChIKey | QKPSKUXMRLYANO-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.61 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |